C12H14N4O3 — CID 110749128
1-(1,4-dioxo-2,3-dihydrophthalazin-5-yl)-3-propylurea (PubChem CID 110749128) has the molecular formula C12H14N4O3 and a molecular weight of 262.27 g/mol. Its IUPAC name is 1-(1,4-dioxo-2,3-dihydrophthalazin-5-yl)-3-propylurea.
| Compound Name | 1-(1,4-dioxo-2,3-dihydrophthalazin-5-yl)-3-propylurea |
|---|---|
| PubChem CID | 110749128 |
| Molecular Formula | C12H14N4O3 |
| Molecular Weight | 262.27 g/mol |
| Exact Mass | 262.11 |
| IUPAC Name | 1-(1,4-dioxo-2,3-dihydrophthalazin-5-yl)-3-propylurea |
| SMILES | CCCNC(=O)Nc1cccc2c(=O)[nH][nH]c(=O)c12 |
| InChI | InChI=1S/C12H14N4O3/c1-2-6-13-12(19)14-8-5-3-4-7-9(8)11(18)16-15-10(7)17/h3-5H,2,6H2,1H3,(H,15,17)(H,16,18)(H2,13,14,19) |
| InChIKey | JFQKEUXSKQRWIL-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 106.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.27 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |