C20H26N4O2Se2 — CID 5272992
1-propyl-3-[2-[[2-(propylcarbamoylamino)phenyl]diselanyl]phenyl]urea (PubChem CID 5272992) has the molecular formula C20H26N4O2Se2 and a molecular weight of 512.37 g/mol. Its IUPAC name is 1-propyl-3-[2-[[2-(propylcarbamoylamino)phenyl]diselanyl]phenyl]urea.
| Compound Name | 1-propyl-3-[2-[[2-(propylcarbamoylamino)phenyl]diselanyl]phenyl]urea |
|---|---|
| PubChem CID | 5272992 |
| Molecular Formula | C20H26N4O2Se2 |
| Molecular Weight | 512.37 g/mol |
| Exact Mass | 514.04 |
| IUPAC Name | 1-propyl-3-[2-[[2-(propylcarbamoylamino)phenyl]diselanyl]phenyl]urea |
| SMILES | CCCNC(=O)Nc1ccccc1[Se][Se]c1ccccc1NC(=O)NCCC |
| InChI | InChI=1S/C20H26N4O2Se2/c1-3-13-21-19(25)23-15-9-5-7-11-17(15)27-28-18-12-8-6-10-16(18)24-20(26)22-14-4-2/h5-12H,3-4,13-14H2,1-2H3,(H2,21,23,25)(H2,22,24,26) |
| InChIKey | MYWLHZCLZMKNAR-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 82.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.37 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|