C11H13N3O4S — CID 64592343
N-(1,4-dioxo-2,3-dihydrophthalazin-5-yl)propane-1-sulfonamide (PubChem CID 64592343) has the molecular formula C11H13N3O4S and a molecular weight of 283.31 g/mol. Its IUPAC name is N-(1,4-dioxo-2,3-dihydrophthalazin-5-yl)propane-1-sulfonamide.
| Compound Name | N-(1,4-dioxo-2,3-dihydrophthalazin-5-yl)propane-1-sulfonamide |
|---|---|
| PubChem CID | 64592343 |
| Molecular Formula | C11H13N3O4S |
| Molecular Weight | 283.31 g/mol |
| Exact Mass | 283.06 |
| IUPAC Name | N-(1,4-dioxo-2,3-dihydrophthalazin-5-yl)propane-1-sulfonamide |
| SMILES | CCCS(=O)(=O)Nc1cccc2c(=O)[nH][nH]c(=O)c12 |
| InChI | InChI=1S/C11H13N3O4S/c1-2-6-19(17,18)14-8-5-3-4-7-9(8)11(16)13-12-10(7)15/h3-5,14H,2,6H2,1H3,(H,12,15)(H,13,16) |
| InChIKey | UJSVUVMKJGTNLS-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 111.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.31 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |