C16H22N2O2 — CID 102273443
5-octyl-2,3-dihydrophthalazine-1,4-dione (PubChem CID 102273443) has the molecular formula C16H22N2O2 and a molecular weight of 274.36 g/mol. Its IUPAC name is 5-octyl-2,3-dihydrophthalazine-1,4-dione.
| Compound Name | 5-octyl-2,3-dihydrophthalazine-1,4-dione |
|---|---|
| PubChem CID | 102273443 |
| Molecular Formula | C16H22N2O2 |
| Molecular Weight | 274.36 g/mol |
| Exact Mass | 274.17 |
| IUPAC Name | 5-octyl-2,3-dihydrophthalazine-1,4-dione |
| SMILES | CCCCCCCCc1cccc2c(=O)[nH][nH]c(=O)c12 |
| InChI | InChI=1S/C16H22N2O2/c1-2-3-4-5-6-7-9-12-10-8-11-13-14(12)16(20)18-17-15(13)19/h8,10-11H,2-7,9H2,1H3,(H,17,19)(H,18,20) |
| InChIKey | OULSSFZOGWOHSN-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 65.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.36 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|