C10H10ClN3O4S — CID 107651738
2-chloro-N-(1,4-dioxo-2,3-dihydrophthalazin-5-yl)ethanesulfonamide (PubChem CID 107651738) has the molecular formula C10H10ClN3O4S and a molecular weight of 303.73 g/mol. Its IUPAC name is 2-chloro-N-(1,4-dioxo-2,3-dihydrophthalazin-5-yl)ethanesulfonamide.
| Compound Name | 2-chloro-N-(1,4-dioxo-2,3-dihydrophthalazin-5-yl)ethanesulfonamide |
|---|---|
| PubChem CID | 107651738 |
| Molecular Formula | C10H10ClN3O4S |
| Molecular Weight | 303.73 g/mol |
| Exact Mass | 303.01 |
| IUPAC Name | 2-chloro-N-(1,4-dioxo-2,3-dihydrophthalazin-5-yl)ethanesulfonamide |
| SMILES | O=c1[nH][nH]c(=O)c2c(NS(=O)(=O)CCCl)cccc12 |
| InChI | InChI=1S/C10H10ClN3O4S/c11-4-5-19(17,18)14-7-3-1-2-6-8(7)10(16)13-12-9(6)15/h1-3,14H,4-5H2,(H,12,15)(H,13,16) |
| InChIKey | MZNWMVOCQDVYIE-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 111.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.73 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|