C8H8Cl3NO2S — CID 103609336
2-chloro-N-(2,3-dichlorophenyl)ethanesulfonamide (PubChem CID 103609336) has the molecular formula C8H8Cl3NO2S and a molecular weight of 288.58 g/mol. Its IUPAC name is 2-chloro-N-(2,3-dichlorophenyl)ethanesulfonamide.
| Compound Name | 2-chloro-N-(2,3-dichlorophenyl)ethanesulfonamide |
|---|---|
| PubChem CID | 103609336 |
| Molecular Formula | C8H8Cl3NO2S |
| Molecular Weight | 288.58 g/mol |
| Exact Mass | 286.93 |
| IUPAC Name | 2-chloro-N-(2,3-dichlorophenyl)ethanesulfonamide |
| SMILES | O=S(=O)(CCCl)Nc1cccc(Cl)c1Cl |
| InChI | InChI=1S/C8H8Cl3NO2S/c9-4-5-15(13,14)12-7-3-1-2-6(10)8(7)11/h1-3,12H,4-5H2 |
| InChIKey | AXAWJYRUXLFCRC-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.58 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|