C15H16Cl2N2O2S — CID 112989699
N-[4-(2,3-dichloroanilino)phenyl]propane-1-sulfonamide (PubChem CID 112989699) has the molecular formula C15H16Cl2N2O2S and a molecular weight of 359.28 g/mol. Its IUPAC name is N-[4-(2,3-dichloroanilino)phenyl]propane-1-sulfonamide.
| Compound Name | N-[4-(2,3-dichloroanilino)phenyl]propane-1-sulfonamide |
|---|---|
| PubChem CID | 112989699 |
| Molecular Formula | C15H16Cl2N2O2S |
| Molecular Weight | 359.28 g/mol |
| Exact Mass | 358.03 |
| IUPAC Name | N-[4-(2,3-dichloroanilino)phenyl]propane-1-sulfonamide |
| SMILES | CCCS(=O)(=O)Nc1ccc(Nc2cccc(Cl)c2Cl)cc1 |
| InChI | InChI=1S/C15H16Cl2N2O2S/c1-2-10-22(20,21)19-12-8-6-11(7-9-12)18-14-5-3-4-13(16)15(14)17/h3-9,18-19H,2,10H2,1H3 |
| InChIKey | KWQKXFBHDYEZDB-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.28 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |