C16H19ClN2O2S — CID 112987095
N-[4-(5-chloro-2-methylanilino)phenyl]propane-1-sulfonamide (PubChem CID 112987095) has the molecular formula C16H19ClN2O2S and a molecular weight of 338.86 g/mol. Its IUPAC name is N-[4-(5-chloro-2-methylanilino)phenyl]propane-1-sulfonamide.
| Compound Name | N-[4-(5-chloro-2-methylanilino)phenyl]propane-1-sulfonamide |
|---|---|
| PubChem CID | 112987095 |
| Molecular Formula | C16H19ClN2O2S |
| Molecular Weight | 338.86 g/mol |
| Exact Mass | 338.09 |
| IUPAC Name | N-[4-(5-chloro-2-methylanilino)phenyl]propane-1-sulfonamide |
| SMILES | CCCS(=O)(=O)Nc1ccc(Nc2cc(Cl)ccc2C)cc1 |
| InChI | InChI=1S/C16H19ClN2O2S/c1-3-10-22(20,21)19-15-8-6-14(7-9-15)18-16-11-13(17)5-4-12(16)2/h4-9,11,18-19H,3,10H2,1-2H3 |
| InChIKey | IFXZIZDGXXHOAJ-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.86 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |