C10H14Cl2N2O2S — CID 106030674
N-(2,3-dichlorophenyl)-1-(methylamino)propane-2-sulfonamide (PubChem CID 106030674) has the molecular formula C10H14Cl2N2O2S and a molecular weight of 297.21 g/mol. Its IUPAC name is N-(2,3-dichlorophenyl)-1-(methylamino)propane-2-sulfonamide.
| Compound Name | N-(2,3-dichlorophenyl)-1-(methylamino)propane-2-sulfonamide |
|---|---|
| PubChem CID | 106030674 |
| Molecular Formula | C10H14Cl2N2O2S |
| Molecular Weight | 297.21 g/mol |
| Exact Mass | 296.02 |
| IUPAC Name | N-(2,3-dichlorophenyl)-1-(methylamino)propane-2-sulfonamide |
| SMILES | CNCC(C)S(=O)(=O)Nc1cccc(Cl)c1Cl |
| InChI | InChI=1S/C10H14Cl2N2O2S/c1-7(6-13-2)17(15,16)14-9-5-3-4-8(11)10(9)12/h3-5,7,13-14H,6H2,1-2H3 |
| InChIKey | OKVFWRIRJAFKSL-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.21 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |