C15H8F3N3O3 — CID 110734426
N-(1,4-dioxo-2,3-dihydrophthalazin-5-yl)-2,3,4-trifluorobenzamide (PubChem CID 110734426) has the molecular formula C15H8F3N3O3 and a molecular weight of 335.24 g/mol. Its IUPAC name is N-(1,4-dioxo-2,3-dihydrophthalazin-5-yl)-2,3,4-trifluorobenzamide.
| Compound Name | N-(1,4-dioxo-2,3-dihydrophthalazin-5-yl)-2,3,4-trifluorobenzamide |
|---|---|
| PubChem CID | 110734426 |
| Molecular Formula | C15H8F3N3O3 |
| Molecular Weight | 335.24 g/mol |
| Exact Mass | 335.05 |
| IUPAC Name | N-(1,4-dioxo-2,3-dihydrophthalazin-5-yl)-2,3,4-trifluorobenzamide |
| SMILES | O=C(Nc1cccc2c(=O)[nH][nH]c(=O)c12)c1ccc(F)c(F)c1F |
| InChI | InChI=1S/C15H8F3N3O3/c16-8-5-4-7(11(17)12(8)18)13(22)19-9-3-1-2-6-10(9)15(24)21-20-14(6)23/h1-5H,(H,19,22)(H,20,23)(H,21,24) |
| InChIKey | IPPLXPGFBBEKAN-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 94.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.24 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|