C11H13N3O3 — CID 11557718
5-(propoxyamino)-2,3-dihydrophthalazine-1,4-dione (PubChem CID 11557718) has the molecular formula C11H13N3O3 and a molecular weight of 235.24 g/mol. Its IUPAC name is 5-(propoxyamino)-2,3-dihydrophthalazine-1,4-dione.
| Compound Name | 5-(propoxyamino)-2,3-dihydrophthalazine-1,4-dione |
|---|---|
| PubChem CID | 11557718 |
| Molecular Formula | C11H13N3O3 |
| Molecular Weight | 235.24 g/mol |
| Exact Mass | 235.10 |
| IUPAC Name | 5-(propoxyamino)-2,3-dihydrophthalazine-1,4-dione |
| SMILES | CCCONc1cccc2c(=O)[nH][nH]c(=O)c12 |
| InChI | InChI=1S/C11H13N3O3/c1-2-6-17-14-8-5-3-4-7-9(8)11(16)13-12-10(7)15/h3-5,14H,2,6H2,1H3,(H,12,15)(H,13,16) |
| InChIKey | GNCJVKQKFQBUJP-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 86.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.24 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|