C10H12N4OSe — CID 62637659
N-(2,1,3-benzoselenadiazol-4-yl)-2-(methylamino)propanamide (PubChem CID 62637659) has the molecular formula C10H12N4OSe and a molecular weight of 283.19 g/mol. Its IUPAC name is N-(2,1,3-benzoselenadiazol-4-yl)-2-(methylamino)propanamide.
| Compound Name | N-(2,1,3-benzoselenadiazol-4-yl)-2-(methylamino)propanamide |
|---|---|
| PubChem CID | 62637659 |
| Molecular Formula | C10H12N4OSe |
| Molecular Weight | 283.19 g/mol |
| Exact Mass | 284.02 |
| IUPAC Name | N-(2,1,3-benzoselenadiazol-4-yl)-2-(methylamino)propanamide |
| SMILES | CNC(C)C(=O)Nc1cccc2n[se]nc12 |
| InChI | InChI=1S/C10H12N4OSe/c1-6(11-2)10(15)12-7-4-3-5-8-9(7)14-16-13-8/h3-6,11H,1-2H3,(H,12,15) |
| InChIKey | HPHNOMOCEXPSLX-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.19 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|