C11H12N4OSe — CID 60843224
N-(2,1,3-benzoselenadiazol-4-yl)-2-(cyclopropylamino)acetamide (PubChem CID 60843224) has the molecular formula C11H12N4OSe and a molecular weight of 295.20 g/mol. Its IUPAC name is N-(2,1,3-benzoselenadiazol-4-yl)-2-(cyclopropylamino)acetamide.
| Compound Name | N-(2,1,3-benzoselenadiazol-4-yl)-2-(cyclopropylamino)acetamide |
|---|---|
| PubChem CID | 60843224 |
| Molecular Formula | C11H12N4OSe |
| Molecular Weight | 295.20 g/mol |
| Exact Mass | 296.02 |
| IUPAC Name | N-(2,1,3-benzoselenadiazol-4-yl)-2-(cyclopropylamino)acetamide |
| SMILES | O=C(CNC1CC1)Nc1cccc2n[se]nc12 |
| InChI | InChI=1S/C11H12N4OSe/c16-10(6-12-7-4-5-7)13-8-2-1-3-9-11(8)15-17-14-9/h1-3,7,12H,4-6H2,(H,13,16) |
| InChIKey | AQMHFJOQKUJXPE-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.20 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|