C12H15N5OSe — CID 54928472
N-(2,1,3-benzoselenadiazol-4-yl)-2-piperazin-1-ylacetamide (PubChem CID 54928472) has the molecular formula C12H15N5OSe and a molecular weight of 324.25 g/mol. Its IUPAC name is N-(2,1,3-benzoselenadiazol-4-yl)-2-piperazin-1-ylacetamide.
| Compound Name | N-(2,1,3-benzoselenadiazol-4-yl)-2-piperazin-1-ylacetamide |
|---|---|
| PubChem CID | 54928472 |
| Molecular Formula | C12H15N5OSe |
| Molecular Weight | 324.25 g/mol |
| Exact Mass | 325.04 |
| IUPAC Name | N-(2,1,3-benzoselenadiazol-4-yl)-2-piperazin-1-ylacetamide |
| SMILES | O=C(CN1CCNCC1)Nc1cccc2n[se]nc12 |
| InChI | InChI=1S/C12H15N5OSe/c18-11(8-17-6-4-13-5-7-17)14-9-2-1-3-10-12(9)16-19-15-10/h1-3,13H,4-8H2,(H,14,18) |
| InChIKey | WCVQPUILDBQHLJ-UHFFFAOYSA-N |
| XLogP | -0.47 |
| TPSA | 70.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.25 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|