C15H22N4O2 — CID 62837195
2-[2-[[2-(1,4-diazepan-1-yl)acetyl]amino]phenyl]acetamide (PubChem CID 62837195) has the molecular formula C15H22N4O2 and a molecular weight of 290.37 g/mol. Its IUPAC name is 2-[2-[[2-(1,4-diazepan-1-yl)acetyl]amino]phenyl]acetamide.
| Compound Name | 2-[2-[[2-(1,4-diazepan-1-yl)acetyl]amino]phenyl]acetamide |
|---|---|
| PubChem CID | 62837195 |
| Molecular Formula | C15H22N4O2 |
| Molecular Weight | 290.37 g/mol |
| Exact Mass | 290.17 |
| IUPAC Name | 2-[2-[[2-(1,4-diazepan-1-yl)acetyl]amino]phenyl]acetamide |
| SMILES | NC(=O)Cc1ccccc1NC(=O)CN1CCCNCC1 |
| InChI | InChI=1S/C15H22N4O2/c16-14(20)10-12-4-1-2-5-13(12)18-15(21)11-19-8-3-6-17-7-9-19/h1-2,4-5,17H,3,6-11H2,(H2,16,20)(H,18,21) |
| InChIKey | RUSXCHHEISPPPJ-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 87.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.37 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |