C14H21N5O2 — CID 62838478
N-[4-(carbamoylamino)phenyl]-2-(1,4-diazepan-1-yl)acetamide (PubChem CID 62838478) has the molecular formula C14H21N5O2 and a molecular weight of 291.35 g/mol. Its IUPAC name is N-[4-(carbamoylamino)phenyl]-2-(1,4-diazepan-1-yl)acetamide.
| Compound Name | N-[4-(carbamoylamino)phenyl]-2-(1,4-diazepan-1-yl)acetamide |
|---|---|
| PubChem CID | 62838478 |
| Molecular Formula | C14H21N5O2 |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.17 |
| IUPAC Name | N-[4-(carbamoylamino)phenyl]-2-(1,4-diazepan-1-yl)acetamide |
| SMILES | NC(=O)Nc1ccc(NC(=O)CN2CCCNCC2)cc1 |
| InChI | InChI=1S/C14H21N5O2/c15-14(21)18-12-4-2-11(3-5-12)17-13(20)10-19-8-1-6-16-7-9-19/h2-5,16H,1,6-10H2,(H,17,20)(H3,15,18,21) |
| InChIKey | CKKBTDWDIGRQPX-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 99.49 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |