C14H19N3O4 — CID 62839797
2-[[2-(1,4-diazepan-1-yl)acetyl]amino]-5-hydroxybenzoic acid (PubChem CID 62839797) has the molecular formula C14H19N3O4 and a molecular weight of 293.32 g/mol. Its IUPAC name is 2-[[2-(1,4-diazepan-1-yl)acetyl]amino]-5-hydroxybenzoic acid.
| Compound Name | 2-[[2-(1,4-diazepan-1-yl)acetyl]amino]-5-hydroxybenzoic acid |
|---|---|
| PubChem CID | 62839797 |
| Molecular Formula | C14H19N3O4 |
| Molecular Weight | 293.32 g/mol |
| Exact Mass | 293.14 |
| IUPAC Name | 2-[[2-(1,4-diazepan-1-yl)acetyl]amino]-5-hydroxybenzoic acid |
| SMILES | O=C(CN1CCCNCC1)Nc1ccc(O)cc1C(=O)O |
| InChI | InChI=1S/C14H19N3O4/c18-10-2-3-12(11(8-10)14(20)21)16-13(19)9-17-6-1-4-15-5-7-17/h2-3,8,15,18H,1,4-7,9H2,(H,16,19)(H,20,21) |
| InChIKey | OKEUCTGBWNNIMZ-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 101.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.32 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|