C13H16BrCl2N3O — CID 107790106
N-(4-bromo-2,3-dichlorophenyl)-2-(1,4-diazepan-1-yl)acetamide (PubChem CID 107790106) has the molecular formula C13H16BrCl2N3O and a molecular weight of 381.10 g/mol. Its IUPAC name is N-(4-bromo-2,3-dichlorophenyl)-2-(1,4-diazepan-1-yl)acetamide.
| Compound Name | N-(4-bromo-2,3-dichlorophenyl)-2-(1,4-diazepan-1-yl)acetamide |
|---|---|
| PubChem CID | 107790106 |
| Molecular Formula | C13H16BrCl2N3O |
| Molecular Weight | 381.10 g/mol |
| Exact Mass | 378.99 |
| IUPAC Name | N-(4-bromo-2,3-dichlorophenyl)-2-(1,4-diazepan-1-yl)acetamide |
| SMILES | O=C(CN1CCCNCC1)Nc1ccc(Br)c(Cl)c1Cl |
| InChI | InChI=1S/C13H16BrCl2N3O/c14-9-2-3-10(13(16)12(9)15)18-11(20)8-19-6-1-4-17-5-7-19/h2-3,17H,1,4-8H2,(H,18,20) |
| InChIKey | QWEXGAGCCSCUCT-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.10 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|