C12H14BrCl2N3O — CID 107790162
N-(4-bromo-2,3-dichlorophenyl)-2-piperazin-1-ylacetamide (PubChem CID 107790162) has the molecular formula C12H14BrCl2N3O and a molecular weight of 367.07 g/mol. Its IUPAC name is N-(4-bromo-2,3-dichlorophenyl)-2-piperazin-1-ylacetamide.
| Compound Name | N-(4-bromo-2,3-dichlorophenyl)-2-piperazin-1-ylacetamide |
|---|---|
| PubChem CID | 107790162 |
| Molecular Formula | C12H14BrCl2N3O |
| Molecular Weight | 367.07 g/mol |
| Exact Mass | 364.97 |
| IUPAC Name | N-(4-bromo-2,3-dichlorophenyl)-2-piperazin-1-ylacetamide |
| SMILES | O=C(CN1CCNCC1)Nc1ccc(Br)c(Cl)c1Cl |
| InChI | InChI=1S/C12H14BrCl2N3O/c13-8-1-2-9(12(15)11(8)14)17-10(19)7-18-5-3-16-4-6-18/h1-2,16H,3-7H2,(H,17,19) |
| InChIKey | FQOSKGJJFGYNHZ-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.07 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|