C13H16FN3O3 — CID 61157931
4-fluoro-2-[(2-piperazin-1-ylacetyl)amino]benzoic acid (PubChem CID 61157931) has the molecular formula C13H16FN3O3 and a molecular weight of 281.29 g/mol. Its IUPAC name is 4-fluoro-2-[(2-piperazin-1-ylacetyl)amino]benzoic acid.
| Compound Name | 4-fluoro-2-[(2-piperazin-1-ylacetyl)amino]benzoic acid |
|---|---|
| PubChem CID | 61157931 |
| Molecular Formula | C13H16FN3O3 |
| Molecular Weight | 281.29 g/mol |
| Exact Mass | 281.12 |
| IUPAC Name | 4-fluoro-2-[(2-piperazin-1-ylacetyl)amino]benzoic acid |
| SMILES | O=C(CN1CCNCC1)Nc1cc(F)ccc1C(=O)O |
| InChI | InChI=1S/C13H16FN3O3/c14-9-1-2-10(13(19)20)11(7-9)16-12(18)8-17-5-3-15-4-6-17/h1-2,7,15H,3-6,8H2,(H,16,18)(H,19,20) |
| InChIKey | NKUGWPRFZVCIEI-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.29 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |