C13H16F2N4O2 — CID 60849658
2,4-difluoro-5-[(2-piperazin-1-ylacetyl)amino]benzamide (PubChem CID 60849658) has the molecular formula C13H16F2N4O2 and a molecular weight of 298.29 g/mol. Its IUPAC name is 2,4-difluoro-5-[(2-piperazin-1-ylacetyl)amino]benzamide.
| Compound Name | 2,4-difluoro-5-[(2-piperazin-1-ylacetyl)amino]benzamide |
|---|---|
| PubChem CID | 60849658 |
| Molecular Formula | C13H16F2N4O2 |
| Molecular Weight | 298.29 g/mol |
| Exact Mass | 298.12 |
| IUPAC Name | 2,4-difluoro-5-[(2-piperazin-1-ylacetyl)amino]benzamide |
| SMILES | NC(=O)c1cc(NC(=O)CN2CCNCC2)c(F)cc1F |
| InChI | InChI=1S/C13H16F2N4O2/c14-9-6-10(15)11(5-8(9)13(16)21)18-12(20)7-19-3-1-17-2-4-19/h5-6,17H,1-4,7H2,(H2,16,21)(H,18,20) |
| InChIKey | FAJRQHTXUIMDKS-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 87.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.29 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |