C13H17FN4O3 — CID 62839860
2-(1,4-diazepan-1-yl)-N-(2-fluoro-5-nitrophenyl)acetamide (PubChem CID 62839860) has the molecular formula C13H17FN4O3 and a molecular weight of 296.30 g/mol. Its IUPAC name is 2-(1,4-diazepan-1-yl)-N-(2-fluoro-5-nitrophenyl)acetamide.
| Compound Name | 2-(1,4-diazepan-1-yl)-N-(2-fluoro-5-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 62839860 |
| Molecular Formula | C13H17FN4O3 |
| Molecular Weight | 296.30 g/mol |
| Exact Mass | 296.13 |
| IUPAC Name | 2-(1,4-diazepan-1-yl)-N-(2-fluoro-5-nitrophenyl)acetamide |
| SMILES | O=C(CN1CCCNCC1)Nc1cc([N+](=O)[O-])ccc1F |
| InChI | InChI=1S/C13H17FN4O3/c14-11-3-2-10(18(20)21)8-12(11)16-13(19)9-17-6-1-4-15-5-7-17/h2-3,8,15H,1,4-7,9H2,(H,16,19) |
| InChIKey | UMHVJZJKJGQDBR-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 87.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.30 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|