C14H21N3O3S — CID 60850903
N-(2-ethylsulfonylphenyl)-2-piperazin-1-ylacetamide (PubChem CID 60850903) has the molecular formula C14H21N3O3S and a molecular weight of 311.41 g/mol. Its IUPAC name is N-(2-ethylsulfonylphenyl)-2-piperazin-1-ylacetamide.
| Compound Name | N-(2-ethylsulfonylphenyl)-2-piperazin-1-ylacetamide |
|---|---|
| PubChem CID | 60850903 |
| Molecular Formula | C14H21N3O3S |
| Molecular Weight | 311.41 g/mol |
| Exact Mass | 311.13 |
| IUPAC Name | N-(2-ethylsulfonylphenyl)-2-piperazin-1-ylacetamide |
| SMILES | CCS(=O)(=O)c1ccccc1NC(=O)CN1CCNCC1 |
| InChI | InChI=1S/C14H21N3O3S/c1-2-21(19,20)13-6-4-3-5-12(13)16-14(18)11-17-9-7-15-8-10-17/h3-6,15H,2,7-11H2,1H3,(H,16,18) |
| InChIKey | NAVGFXNNPPSLAQ-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.41 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |