C13H16N2O3S — CID 79287541
N-(2-ethylsulfonylphenyl)-2-(prop-2-ynylamino)acetamide (PubChem CID 79287541) has the molecular formula C13H16N2O3S and a molecular weight of 280.35 g/mol. Its IUPAC name is N-(2-ethylsulfonylphenyl)-2-(prop-2-ynylamino)acetamide.
| Compound Name | N-(2-ethylsulfonylphenyl)-2-(prop-2-ynylamino)acetamide |
|---|---|
| PubChem CID | 79287541 |
| Molecular Formula | C13H16N2O3S |
| Molecular Weight | 280.35 g/mol |
| Exact Mass | 280.09 |
| IUPAC Name | N-(2-ethylsulfonylphenyl)-2-(prop-2-ynylamino)acetamide |
| SMILES | C#CCNCC(=O)Nc1ccccc1S(=O)(=O)CC |
| InChI | InChI=1S/C13H16N2O3S/c1-3-9-14-10-13(16)15-11-7-5-6-8-12(11)19(17,18)4-2/h1,5-8,14H,4,9-10H2,2H3,(H,15,16) |
| InChIKey | UJXJFSPLBHCQLZ-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.35 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|