C13H14N2O3 — CID 79271614
2-[2-[[2-(prop-2-ynylamino)acetyl]amino]phenyl]acetic acid (PubChem CID 79271614) has the molecular formula C13H14N2O3 and a molecular weight of 246.27 g/mol. Its IUPAC name is 2-[2-[[2-(prop-2-ynylamino)acetyl]amino]phenyl]acetic acid.
| Compound Name | 2-[2-[[2-(prop-2-ynylamino)acetyl]amino]phenyl]acetic acid |
|---|---|
| PubChem CID | 79271614 |
| Molecular Formula | C13H14N2O3 |
| Molecular Weight | 246.27 g/mol |
| Exact Mass | 246.10 |
| IUPAC Name | 2-[2-[[2-(prop-2-ynylamino)acetyl]amino]phenyl]acetic acid |
| SMILES | C#CCNCC(=O)Nc1ccccc1CC(=O)O |
| InChI | InChI=1S/C13H14N2O3/c1-2-7-14-9-12(16)15-11-6-4-3-5-10(11)8-13(17)18/h1,3-6,14H,7-9H2,(H,15,16)(H,17,18) |
| InChIKey | CSZQAYGYMBKTBC-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.27 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|