C16H19N3OS — CID 60850013
2-piperazin-1-yl-N-(2-thiophen-2-ylphenyl)acetamide (PubChem CID 60850013) has the molecular formula C16H19N3OS and a molecular weight of 301.41 g/mol. Its IUPAC name is 2-piperazin-1-yl-N-(2-thiophen-2-ylphenyl)acetamide.
| Compound Name | 2-piperazin-1-yl-N-(2-thiophen-2-ylphenyl)acetamide |
|---|---|
| PubChem CID | 60850013 |
| Molecular Formula | C16H19N3OS |
| Molecular Weight | 301.41 g/mol |
| Exact Mass | 301.12 |
| IUPAC Name | 2-piperazin-1-yl-N-(2-thiophen-2-ylphenyl)acetamide |
| SMILES | O=C(CN1CCNCC1)Nc1ccccc1-c1cccs1 |
| InChI | InChI=1S/C16H19N3OS/c20-16(12-19-9-7-17-8-10-19)18-14-5-2-1-4-13(14)15-6-3-11-21-15/h1-6,11,17H,7-10,12H2,(H,18,20) |
| InChIKey | VGNRVAGNGUOZAN-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.41 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |