C10H10ClN3OSe — CID 63307741
N-(2,1,3-benzoselenadiazol-4-yl)-4-chlorobutanamide (PubChem CID 63307741) has the molecular formula C10H10ClN3OSe and a molecular weight of 302.62 g/mol. Its IUPAC name is N-(2,1,3-benzoselenadiazol-4-yl)-4-chlorobutanamide.
| Compound Name | N-(2,1,3-benzoselenadiazol-4-yl)-4-chlorobutanamide |
|---|---|
| PubChem CID | 63307741 |
| Molecular Formula | C10H10ClN3OSe |
| Molecular Weight | 302.62 g/mol |
| Exact Mass | 302.97 |
| IUPAC Name | N-(2,1,3-benzoselenadiazol-4-yl)-4-chlorobutanamide |
| SMILES | O=C(CCCCl)Nc1cccc2n[se]nc12 |
| InChI | InChI=1S/C10H10ClN3OSe/c11-6-2-5-9(15)12-7-3-1-4-8-10(7)14-16-13-8/h1,3-4H,2,5-6H2,(H,12,15) |
| InChIKey | XDDJOPSONXZXMC-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.62 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|