C11H12N4O3Se — CID 64895809
4-amino-5-(2,1,3-benzoselenadiazol-4-ylamino)-5-oxopentanoic acid (PubChem CID 64895809) has the molecular formula C11H12N4O3Se and a molecular weight of 327.20 g/mol. Its IUPAC name is 4-amino-5-(2,1,3-benzoselenadiazol-4-ylamino)-5-oxopentanoic acid.
| Compound Name | 4-amino-5-(2,1,3-benzoselenadiazol-4-ylamino)-5-oxopentanoic acid |
|---|---|
| PubChem CID | 64895809 |
| Molecular Formula | C11H12N4O3Se |
| Molecular Weight | 327.20 g/mol |
| Exact Mass | 328.01 |
| IUPAC Name | 4-amino-5-(2,1,3-benzoselenadiazol-4-ylamino)-5-oxopentanoic acid |
| SMILES | NC(CCC(=O)O)C(=O)Nc1cccc2n[se]nc12 |
| InChI | InChI=1S/C11H12N4O3Se/c12-6(4-5-9(16)17)11(18)13-7-2-1-3-8-10(7)15-19-14-8/h1-3,6H,4-5,12H2,(H,13,18)(H,16,17) |
| InChIKey | WLRTWMUPWGFPRT-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 118.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.20 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|