C13H15N5O3 — CID 64889290
4-amino-5-oxo-5-[(2-pyrazol-1-yl-3-pyridinyl)amino]pentanoic acid (PubChem CID 64889290) has the molecular formula C13H15N5O3 and a molecular weight of 289.30 g/mol. Its IUPAC name is 4-amino-5-oxo-5-[(2-pyrazol-1-yl-3-pyridinyl)amino]pentanoic acid.
| Compound Name | 4-amino-5-oxo-5-[(2-pyrazol-1-yl-3-pyridinyl)amino]pentanoic acid |
|---|---|
| PubChem CID | 64889290 |
| Molecular Formula | C13H15N5O3 |
| Molecular Weight | 289.30 g/mol |
| Exact Mass | 289.12 |
| IUPAC Name | 4-amino-5-oxo-5-[(2-pyrazol-1-yl-3-pyridinyl)amino]pentanoic acid |
| SMILES | NC(CCC(=O)O)C(=O)Nc1cccnc1-n1cccn1 |
| InChI | InChI=1S/C13H15N5O3/c14-9(4-5-11(19)20)13(21)17-10-3-1-6-15-12(10)18-8-2-7-16-18/h1-3,6-9H,4-5,14H2,(H,17,21)(H,19,20) |
| InChIKey | IUTZOIVHEKNDON-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 123.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.30 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |