C9H12N4O3 — CID 64895405
4-amino-5-oxo-5-(pyrimidin-2-ylamino)pentanoic acid (PubChem CID 64895405) has the molecular formula C9H12N4O3 and a molecular weight of 224.22 g/mol. Its IUPAC name is 4-amino-5-oxo-5-(pyrimidin-2-ylamino)pentanoic acid.
| Compound Name | 4-amino-5-oxo-5-(pyrimidin-2-ylamino)pentanoic acid |
|---|---|
| PubChem CID | 64895405 |
| Molecular Formula | C9H12N4O3 |
| Molecular Weight | 224.22 g/mol |
| Exact Mass | 224.09 |
| IUPAC Name | 4-amino-5-oxo-5-(pyrimidin-2-ylamino)pentanoic acid |
| SMILES | NC(CCC(=O)O)C(=O)Nc1ncccn1 |
| InChI | InChI=1S/C9H12N4O3/c10-6(2-3-7(14)15)8(16)13-9-11-4-1-5-12-9/h1,4-6H,2-3,10H2,(H,14,15)(H,11,12,13,16) |
| InChIKey | QIHRPMOPPKIPQL-UHFFFAOYSA-N |
| XLogP | -0.39 |
| TPSA | 118.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.22 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |