C14H15N3O3S — CID 64888719
4-amino-5-oxo-5-[4-(1,3-thiazol-2-yl)anilino]pentanoic acid (PubChem CID 64888719) has the molecular formula C14H15N3O3S and a molecular weight of 305.36 g/mol. Its IUPAC name is 4-amino-5-oxo-5-[4-(1,3-thiazol-2-yl)anilino]pentanoic acid.
| Compound Name | 4-amino-5-oxo-5-[4-(1,3-thiazol-2-yl)anilino]pentanoic acid |
|---|---|
| PubChem CID | 64888719 |
| Molecular Formula | C14H15N3O3S |
| Molecular Weight | 305.36 g/mol |
| Exact Mass | 305.08 |
| IUPAC Name | 4-amino-5-oxo-5-[4-(1,3-thiazol-2-yl)anilino]pentanoic acid |
| SMILES | NC(CCC(=O)O)C(=O)Nc1ccc(-c2nccs2)cc1 |
| InChI | InChI=1S/C14H15N3O3S/c15-11(5-6-12(18)19)13(20)17-10-3-1-9(2-4-10)14-16-7-8-21-14/h1-4,7-8,11H,5-6,15H2,(H,17,20)(H,18,19) |
| InChIKey | VXPQCAOCFVZUBH-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 105.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.36 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |