C14H20N4OSe — CID 65290319
6-amino-N-(2,1,3-benzoselenadiazol-4-yl)-2-methylheptanamide (PubChem CID 65290319) has the molecular formula C14H20N4OSe and a molecular weight of 339.30 g/mol. Its IUPAC name is 6-amino-N-(2,1,3-benzoselenadiazol-4-yl)-2-methylheptanamide.
| Compound Name | 6-amino-N-(2,1,3-benzoselenadiazol-4-yl)-2-methylheptanamide |
|---|---|
| PubChem CID | 65290319 |
| Molecular Formula | C14H20N4OSe |
| Molecular Weight | 339.30 g/mol |
| Exact Mass | 340.08 |
| IUPAC Name | 6-amino-N-(2,1,3-benzoselenadiazol-4-yl)-2-methylheptanamide |
| SMILES | CC(N)CCCC(C)C(=O)Nc1cccc2n[se]nc12 |
| InChI | InChI=1S/C14H20N4OSe/c1-9(5-3-6-10(2)15)14(19)16-11-7-4-8-12-13(11)18-20-17-12/h4,7-10H,3,5-6,15H2,1-2H3,(H,16,19) |
| InChIKey | QJXZHJGQJZFBRK-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.30 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|