C12H13N3O3Se — CID 60636239
ethyl 4-(2,1,3-benzoselenadiazol-4-ylamino)-4-oxobutanoate (PubChem CID 60636239) has the molecular formula C12H13N3O3Se and a molecular weight of 326.21 g/mol. Its IUPAC name is ethyl 4-(2,1,3-benzoselenadiazol-4-ylamino)-4-oxobutanoate.
| Compound Name | ethyl 4-(2,1,3-benzoselenadiazol-4-ylamino)-4-oxobutanoate |
|---|---|
| PubChem CID | 60636239 |
| Molecular Formula | C12H13N3O3Se |
| Molecular Weight | 326.21 g/mol |
| Exact Mass | 327.01 |
| IUPAC Name | ethyl 4-(2,1,3-benzoselenadiazol-4-ylamino)-4-oxobutanoate |
| SMILES | CCOC(=O)CCC(=O)Nc1cccc2n[se]nc12 |
| InChI | InChI=1S/C12H13N3O3Se/c1-2-18-11(17)7-6-10(16)13-8-4-3-5-9-12(8)15-19-14-9/h3-5H,2,6-7H2,1H3,(H,13,16) |
| InChIKey | ZZEBNLPVHHALOF-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.21 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|