C14H19NO3S — CID 61061323
ethyl 4-(2-ethylsulfanylanilino)-4-oxobutanoate (PubChem CID 61061323) has the molecular formula C14H19NO3S and a molecular weight of 281.38 g/mol. Its IUPAC name is ethyl 4-(2-ethylsulfanylanilino)-4-oxobutanoate.
| Compound Name | ethyl 4-(2-ethylsulfanylanilino)-4-oxobutanoate |
|---|---|
| PubChem CID | 61061323 |
| Molecular Formula | C14H19NO3S |
| Molecular Weight | 281.38 g/mol |
| Exact Mass | 281.11 |
| IUPAC Name | ethyl 4-(2-ethylsulfanylanilino)-4-oxobutanoate |
| SMILES | CCOC(=O)CCC(=O)Nc1ccccc1SCC |
| InChI | InChI=1S/C14H19NO3S/c1-3-18-14(17)10-9-13(16)15-11-7-5-6-8-12(11)19-4-2/h5-8H,3-4,9-10H2,1-2H3,(H,15,16) |
| InChIKey | MFYKNXLWXFZIQV-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.38 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |