C13H18N2O5S — CID 61362191
ethyl 4-(2-methyl-3-sulfamoylanilino)-4-oxobutanoate (PubChem CID 61362191) has the molecular formula C13H18N2O5S and a molecular weight of 314.36 g/mol. Its IUPAC name is ethyl 4-(2-methyl-3-sulfamoylanilino)-4-oxobutanoate.
| Compound Name | ethyl 4-(2-methyl-3-sulfamoylanilino)-4-oxobutanoate |
|---|---|
| PubChem CID | 61362191 |
| Molecular Formula | C13H18N2O5S |
| Molecular Weight | 314.36 g/mol |
| Exact Mass | 314.09 |
| IUPAC Name | ethyl 4-(2-methyl-3-sulfamoylanilino)-4-oxobutanoate |
| SMILES | CCOC(=O)CCC(=O)Nc1cccc(S(N)(=O)=O)c1C |
| InChI | InChI=1S/C13H18N2O5S/c1-3-20-13(17)8-7-12(16)15-10-5-4-6-11(9(10)2)21(14,18)19/h4-6H,3,7-8H2,1-2H3,(H,15,16)(H2,14,18,19) |
| InChIKey | BPFBBEOLWXFERY-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 115.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.36 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |