C10H12N2O5S — CID 61129519
4-oxo-4-(2-sulfamoylanilino)butanoic acid (PubChem CID 61129519) has the molecular formula C10H12N2O5S and a molecular weight of 272.28 g/mol. Its IUPAC name is 4-oxo-4-(2-sulfamoylanilino)butanoic acid.
| Compound Name | 4-oxo-4-(2-sulfamoylanilino)butanoic acid |
|---|---|
| PubChem CID | 61129519 |
| Molecular Formula | C10H12N2O5S |
| Molecular Weight | 272.28 g/mol |
| Exact Mass | 272.05 |
| IUPAC Name | 4-oxo-4-(2-sulfamoylanilino)butanoic acid |
| SMILES | NS(=O)(=O)c1ccccc1NC(=O)CCC(=O)O |
| InChI | InChI=1S/C10H12N2O5S/c11-18(16,17)8-4-2-1-3-7(8)12-9(13)5-6-10(14)15/h1-4H,5-6H2,(H,12,13)(H,14,15)(H2,11,16,17) |
| InChIKey | ALUWFFOOULDTQC-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 126.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.28 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |