C22H22N4O6S2 — CID 10207318
N-[3-oxo-3-(2-sulfamoylanilino)propyl]-4-(2-sulfamoylphenyl)benzamide (PubChem CID 10207318) has the molecular formula C22H22N4O6S2 and a molecular weight of 502.57 g/mol. Its IUPAC name is N-[3-oxo-3-(2-sulfamoylanilino)propyl]-4-(2-sulfamoylphenyl)benzamide.
| Compound Name | N-[3-oxo-3-(2-sulfamoylanilino)propyl]-4-(2-sulfamoylphenyl)benzamide |
|---|---|
| PubChem CID | 10207318 |
| Molecular Formula | C22H22N4O6S2 |
| Molecular Weight | 502.57 g/mol |
| Exact Mass | 502.10 |
| IUPAC Name | N-[3-oxo-3-(2-sulfamoylanilino)propyl]-4-(2-sulfamoylphenyl)benzamide |
| SMILES | NS(=O)(=O)c1ccccc1NC(=O)CCNC(=O)c1ccc(-c2ccccc2S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C22H22N4O6S2/c23-33(29,30)19-7-3-1-5-17(19)15-9-11-16(12-10-15)22(28)25-14-13-21(27)26-18-6-2-4-8-20(18)34(24,31)32/h1-12H,13-14H2,(H,25,28)(H,26,27)(H2,23,29,30)(H2,24,31,32) |
| InChIKey | MEWZLFVZZQZELW-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 178.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.57 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |