C24H25N3O3S — CID 142030083
N-[3-[3-(1-aminoethenyl)phenyl]propyl]-4-(2-sulfamoylphenyl)benzamide (PubChem CID 142030083) has the molecular formula C24H25N3O3S and a molecular weight of 435.55 g/mol. Its IUPAC name is N-[3-[3-(1-aminoethenyl)phenyl]propyl]-4-(2-sulfamoylphenyl)benzamide.
| Compound Name | N-[3-[3-(1-aminoethenyl)phenyl]propyl]-4-(2-sulfamoylphenyl)benzamide |
|---|---|
| PubChem CID | 142030083 |
| Molecular Formula | C24H25N3O3S |
| Molecular Weight | 435.55 g/mol |
| Exact Mass | 435.16 |
| IUPAC Name | N-[3-[3-(1-aminoethenyl)phenyl]propyl]-4-(2-sulfamoylphenyl)benzamide |
| SMILES | C=C(N)c1cccc(CCCNC(=O)c2ccc(-c3ccccc3S(N)(=O)=O)cc2)c1 |
| InChI | InChI=1S/C24H25N3O3S/c1-17(25)21-8-4-6-18(16-21)7-5-15-27-24(28)20-13-11-19(12-14-20)22-9-2-3-10-23(22)31(26,29)30/h2-4,6,8-14,16H,1,5,7,15,25H2,(H,27,28)(H2,26,29,30) |
| InChIKey | XKGOXYRIQBHVFL-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 115.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.55 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|