C22H18F2N4O6S — CID 10118025
N-[3-(4,5-difluoro-2-nitroanilino)-3-oxopropyl]-4-(2-sulfamoylphenyl)benzamide (PubChem CID 10118025) has the molecular formula C22H18F2N4O6S and a molecular weight of 504.47 g/mol. Its IUPAC name is N-[3-(4,5-difluoro-2-nitroanilino)-3-oxopropyl]-4-(2-sulfamoylphenyl)benzamide.
| Compound Name | N-[3-(4,5-difluoro-2-nitroanilino)-3-oxopropyl]-4-(2-sulfamoylphenyl)benzamide |
|---|---|
| PubChem CID | 10118025 |
| Molecular Formula | C22H18F2N4O6S |
| Molecular Weight | 504.47 g/mol |
| Exact Mass | 504.09 |
| IUPAC Name | N-[3-(4,5-difluoro-2-nitroanilino)-3-oxopropyl]-4-(2-sulfamoylphenyl)benzamide |
| SMILES | NS(=O)(=O)c1ccccc1-c1ccc(C(=O)NCCC(=O)Nc2cc(F)c(F)cc2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C22H18F2N4O6S/c23-16-11-18(19(28(31)32)12-17(16)24)27-21(29)9-10-26-22(30)14-7-5-13(6-8-14)15-3-1-2-4-20(15)35(25,33)34/h1-8,11-12H,9-10H2,(H,26,30)(H,27,29)(H2,25,33,34) |
| InChIKey | CBSSVVKGMKCGHY-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 161.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.47 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|