C23H21BrN4O5S — CID 142065418
4-[2-(amino-methylidene-oxo-λ6-sulfanyl)phenyl]-N-[3-(4-bromo-2-nitroanilino)-3-oxopropyl]benzamide (PubChem CID 142065418) has the molecular formula C23H21BrN4O5S and a molecular weight of 545.42 g/mol. Its IUPAC name is 4-[2-(amino-methylidene-oxo-λ6-sulfanyl)phenyl]-N-[3-(4-bromo-2-nitroanilino)-3-oxopropyl]benzamide.
| Compound Name | 4-[2-(amino-methylidene-oxo-λ6-sulfanyl)phenyl]-N-[3-(4-bromo-2-nitroanilino)-3-oxopropyl]benzamide |
|---|---|
| PubChem CID | 142065418 |
| Molecular Formula | C23H21BrN4O5S |
| Molecular Weight | 545.42 g/mol |
| Exact Mass | 544.04 |
| IUPAC Name | 4-[2-(amino-methylidene-oxo-λ6-sulfanyl)phenyl]-N-[3-(4-bromo-2-nitroanilino)-3-oxopropyl]benzamide |
| SMILES | C=S(N)(=O)c1ccccc1-c1ccc(C(=O)NCCC(=O)Nc2ccc(Br)cc2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C23H21BrN4O5S/c1-34(25,33)21-5-3-2-4-18(21)15-6-8-16(9-7-15)23(30)26-13-12-22(29)27-19-11-10-17(24)14-20(19)28(31)32/h2-11,14H,1,12-13H2,(H2,25,33)(H,26,30)(H,27,29) |
| InChIKey | UFOKFPWPUIHLLX-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 144.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.42 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|