C22H21FN4O — CID 176943782
N-[3-[4-(2-fluorophenyl)phenyl]propyl]-2,3-dihydro-1H-benzotriazole-5-carboxamide (PubChem CID 176943782) has the molecular formula C22H21FN4O and a molecular weight of 376.44 g/mol. Its IUPAC name is N-[3-[4-(2-fluorophenyl)phenyl]propyl]-2,3-dihydro-1H-benzotriazole-5-carboxamide.
| Compound Name | N-[3-[4-(2-fluorophenyl)phenyl]propyl]-2,3-dihydro-1H-benzotriazole-5-carboxamide |
|---|---|
| PubChem CID | 176943782 |
| Molecular Formula | C22H21FN4O |
| Molecular Weight | 376.44 g/mol |
| Exact Mass | 376.17 |
| IUPAC Name | N-[3-[4-(2-fluorophenyl)phenyl]propyl]-2,3-dihydro-1H-benzotriazole-5-carboxamide |
| SMILES | O=C(NCCCc1ccc(-c2ccccc2F)cc1)c1ccc2c(c1)NNN2 |
| InChI | InChI=1S/C22H21FN4O/c23-19-6-2-1-5-18(19)16-9-7-15(8-10-16)4-3-13-24-22(28)17-11-12-20-21(14-17)26-27-25-20/h1-2,5-12,14,25-27H,3-4,13H2,(H,24,28) |
| InChIKey | QXRBVAADWTVXEX-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 65.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.44 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|