C23H20FN3O — CID 138674482
N-[3-[4-(2-fluorophenyl)phenyl]propyl]-1H-pyrrolo[2,3-b]pyridine-2-carboxamide (PubChem CID 138674482) has the molecular formula C23H20FN3O and a molecular weight of 373.43 g/mol. Its IUPAC name is N-[3-[4-(2-fluorophenyl)phenyl]propyl]-1H-pyrrolo[2,3-b]pyridine-2-carboxamide.
| Compound Name | N-[3-[4-(2-fluorophenyl)phenyl]propyl]-1H-pyrrolo[2,3-b]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 138674482 |
| Molecular Formula | C23H20FN3O |
| Molecular Weight | 373.43 g/mol |
| Exact Mass | 373.16 |
| IUPAC Name | N-[3-[4-(2-fluorophenyl)phenyl]propyl]-1H-pyrrolo[2,3-b]pyridine-2-carboxamide |
| SMILES | O=C(NCCCc1ccc(-c2ccccc2F)cc1)c1cc2cccnc2[nH]1 |
| InChI | InChI=1S/C23H20FN3O/c24-20-8-2-1-7-19(20)17-11-9-16(10-12-17)5-3-14-26-23(28)21-15-18-6-4-13-25-22(18)27-21/h1-2,4,6-13,15H,3,5,14H2,(H,25,27)(H,26,28) |
| InChIKey | PKRFIUMUVHSGIK-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.43 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|