C22H21FN2O — CID 138674657
N-[3-[4-(2-fluorophenyl)phenyl]propyl]-5-methylpyridine-3-carboxamide (PubChem CID 138674657) has the molecular formula C22H21FN2O and a molecular weight of 348.42 g/mol. Its IUPAC name is N-[3-[4-(2-fluorophenyl)phenyl]propyl]-5-methylpyridine-3-carboxamide.
| Compound Name | N-[3-[4-(2-fluorophenyl)phenyl]propyl]-5-methylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 138674657 |
| Molecular Formula | C22H21FN2O |
| Molecular Weight | 348.42 g/mol |
| Exact Mass | 348.16 |
| IUPAC Name | N-[3-[4-(2-fluorophenyl)phenyl]propyl]-5-methylpyridine-3-carboxamide |
| SMILES | Cc1cncc(C(=O)NCCCc2ccc(-c3ccccc3F)cc2)c1 |
| InChI | InChI=1S/C22H21FN2O/c1-16-13-19(15-24-14-16)22(26)25-12-4-5-17-8-10-18(11-9-17)20-6-2-3-7-21(20)23/h2-3,6-11,13-15H,4-5,12H2,1H3,(H,25,26) |
| InChIKey | LBONOCCEPMTNEU-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.42 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|