C20H19FN2OS — CID 138674443
N-[3-[4-(2-fluorophenyl)phenyl]propyl]-5-methyl-1,3-thiazole-2-carboxamide (PubChem CID 138674443) has the molecular formula C20H19FN2OS and a molecular weight of 354.45 g/mol. Its IUPAC name is N-[3-[4-(2-fluorophenyl)phenyl]propyl]-5-methyl-1,3-thiazole-2-carboxamide.
| Compound Name | N-[3-[4-(2-fluorophenyl)phenyl]propyl]-5-methyl-1,3-thiazole-2-carboxamide |
|---|---|
| PubChem CID | 138674443 |
| Molecular Formula | C20H19FN2OS |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.12 |
| IUPAC Name | N-[3-[4-(2-fluorophenyl)phenyl]propyl]-5-methyl-1,3-thiazole-2-carboxamide |
| SMILES | Cc1cnc(C(=O)NCCCc2ccc(-c3ccccc3F)cc2)s1 |
| InChI | InChI=1S/C20H19FN2OS/c1-14-13-23-20(25-14)19(24)22-12-4-5-15-8-10-16(11-9-15)17-6-2-3-7-18(17)21/h2-3,6-11,13H,4-5,12H2,1H3,(H,22,24) |
| InChIKey | ZACWEPYURNOPMZ-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|