C13H15N3OS — CID 71807159
3-methyl-N-(3-phenylpropyl)-1,2,4-thiadiazole-5-carboxamide (PubChem CID 71807159) has the molecular formula C13H15N3OS and a molecular weight of 261.35 g/mol. Its IUPAC name is 3-methyl-N-(3-phenylpropyl)-1,2,4-thiadiazole-5-carboxamide.
| Compound Name | 3-methyl-N-(3-phenylpropyl)-1,2,4-thiadiazole-5-carboxamide |
|---|---|
| PubChem CID | 71807159 |
| Molecular Formula | C13H15N3OS |
| Molecular Weight | 261.35 g/mol |
| Exact Mass | 261.09 |
| IUPAC Name | 3-methyl-N-(3-phenylpropyl)-1,2,4-thiadiazole-5-carboxamide |
| SMILES | Cc1nsc(C(=O)NCCCc2ccccc2)n1 |
| InChI | InChI=1S/C13H15N3OS/c1-10-15-13(18-16-10)12(17)14-9-5-8-11-6-3-2-4-7-11/h2-4,6-7H,5,8-9H2,1H3,(H,14,17) |
| InChIKey | MVOSVWHHWUFCKY-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.35 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|