C22H24N2O — CID 50765976
2,6,8-trimethyl-N-(3-phenylpropyl)quinoline-4-carboxamide (PubChem CID 50765976) has the molecular formula C22H24N2O and a molecular weight of 332.45 g/mol. Its IUPAC name is 2,6,8-trimethyl-N-(3-phenylpropyl)quinoline-4-carboxamide.
| Compound Name | 2,6,8-trimethyl-N-(3-phenylpropyl)quinoline-4-carboxamide |
|---|---|
| PubChem CID | 50765976 |
| Molecular Formula | C22H24N2O |
| Molecular Weight | 332.45 g/mol |
| Exact Mass | 332.19 |
| IUPAC Name | 2,6,8-trimethyl-N-(3-phenylpropyl)quinoline-4-carboxamide |
| SMILES | Cc1cc(C)c2nc(C)cc(C(=O)NCCCc3ccccc3)c2c1 |
| InChI | InChI=1S/C22H24N2O/c1-15-12-16(2)21-19(13-15)20(14-17(3)24-21)22(25)23-11-7-10-18-8-5-4-6-9-18/h4-6,8-9,12-14H,7,10-11H2,1-3H3,(H,23,25) |
| InChIKey | DXFJQDMJSMIOFJ-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.45 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|