C20H25NO2 — CID 112978152
N-(3-phenylpropyl)-2-(2,4,6-trimethylphenoxy)acetamide (PubChem CID 112978152) has the molecular formula C20H25NO2 and a molecular weight of 311.43 g/mol. Its IUPAC name is N-(3-phenylpropyl)-2-(2,4,6-trimethylphenoxy)acetamide.
| Compound Name | N-(3-phenylpropyl)-2-(2,4,6-trimethylphenoxy)acetamide |
|---|---|
| PubChem CID | 112978152 |
| Molecular Formula | C20H25NO2 |
| Molecular Weight | 311.43 g/mol |
| Exact Mass | 311.19 |
| IUPAC Name | N-(3-phenylpropyl)-2-(2,4,6-trimethylphenoxy)acetamide |
| SMILES | Cc1cc(C)c(OCC(=O)NCCCc2ccccc2)c(C)c1 |
| InChI | InChI=1S/C20H25NO2/c1-15-12-16(2)20(17(3)13-15)23-14-19(22)21-11-7-10-18-8-5-4-6-9-18/h4-6,8-9,12-13H,7,10-11,14H2,1-3H3,(H,21,22) |
| InChIKey | XFKIOUSWIFHGKQ-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.43 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|