C15H21NO5 — CID 107831855
2-hydroxy-4-[[2-(2,4,6-trimethylphenoxy)acetyl]amino]butanoic acid (PubChem CID 107831855) has the molecular formula C15H21NO5 and a molecular weight of 295.34 g/mol. Its IUPAC name is 2-hydroxy-4-[[2-(2,4,6-trimethylphenoxy)acetyl]amino]butanoic acid.
| Compound Name | 2-hydroxy-4-[[2-(2,4,6-trimethylphenoxy)acetyl]amino]butanoic acid |
|---|---|
| PubChem CID | 107831855 |
| Molecular Formula | C15H21NO5 |
| Molecular Weight | 295.34 g/mol |
| Exact Mass | 295.14 |
| IUPAC Name | 2-hydroxy-4-[[2-(2,4,6-trimethylphenoxy)acetyl]amino]butanoic acid |
| SMILES | Cc1cc(C)c(OCC(=O)NCCC(O)C(=O)O)c(C)c1 |
| InChI | InChI=1S/C15H21NO5/c1-9-6-10(2)14(11(3)7-9)21-8-13(18)16-5-4-12(17)15(19)20/h6-7,12,17H,4-5,8H2,1-3H3,(H,16,18)(H,19,20) |
| InChIKey | HEOAKCGSVAAXRO-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.34 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |