C22H28N2O3S — CID 11902798
2-[(S)-[2-oxo-2-(2,4,6-trimethylanilino)ethyl]sulfinyl]-N-(3-phenylpropyl)acetamide (PubChem CID 11902798) has the molecular formula C22H28N2O3S and a molecular weight of 400.54 g/mol. Its IUPAC name is 2-[(S)-[2-oxo-2-(2,4,6-trimethylanilino)ethyl]sulfinyl]-N-(3-phenylpropyl)acetamide.
| Compound Name | 2-[(S)-[2-oxo-2-(2,4,6-trimethylanilino)ethyl]sulfinyl]-N-(3-phenylpropyl)acetamide |
|---|---|
| PubChem CID | 11902798 |
| Molecular Formula | C22H28N2O3S |
| Molecular Weight | 400.54 g/mol |
| Exact Mass | 400.18 |
| IUPAC Name | 2-[(S)-[2-oxo-2-(2,4,6-trimethylanilino)ethyl]sulfinyl]-N-(3-phenylpropyl)acetamide |
| SMILES | Cc1cc(C)c(NC(=O)C[S@@](=O)CC(=O)NCCCc2ccccc2)c(C)c1 |
| InChI | InChI=1S/C22H28N2O3S/c1-16-12-17(2)22(18(3)13-16)24-21(26)15-28(27)14-20(25)23-11-7-10-19-8-5-4-6-9-19/h4-6,8-9,12-13H,7,10-11,14-15H2,1-3H3,(H,23,25)(H,24,26)/t28-/m0/s1 |
| InChIKey | SKHOWWDVGDFHCV-NDEPHWFRSA-N |
| XLogP | 3.05 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.54 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|