C21H18F4N2OS — CID 138674676
N-[3-[4-[2-fluoro-3-(trifluoromethyl)phenyl]phenyl]propyl]-2-methyl-1,3-thiazole-5-carboxamide (PubChem CID 138674676) has the molecular formula C21H18F4N2OS and a molecular weight of 422.45 g/mol. Its IUPAC name is N-[3-[4-[2-fluoro-3-(trifluoromethyl)phenyl]phenyl]propyl]-2-methyl-1,3-thiazole-5-carboxamide.
| Compound Name | N-[3-[4-[2-fluoro-3-(trifluoromethyl)phenyl]phenyl]propyl]-2-methyl-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 138674676 |
| Molecular Formula | C21H18F4N2OS |
| Molecular Weight | 422.45 g/mol |
| Exact Mass | 422.11 |
| IUPAC Name | N-[3-[4-[2-fluoro-3-(trifluoromethyl)phenyl]phenyl]propyl]-2-methyl-1,3-thiazole-5-carboxamide |
| SMILES | Cc1ncc(C(=O)NCCCc2ccc(-c3cccc(C(F)(F)F)c3F)cc2)s1 |
| InChI | InChI=1S/C21H18F4N2OS/c1-13-27-12-18(29-13)20(28)26-11-3-4-14-7-9-15(10-8-14)16-5-2-6-17(19(16)22)21(23,24)25/h2,5-10,12H,3-4,11H2,1H3,(H,26,28) |
| InChIKey | DUIURPDGMCHCQG-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.45 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|